C24H34N4O3S2 — CID 24643649
N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-1-(5-methylthiophen-2-yl)sulfonylpiperidine-3-carboxamide (PubChem CID 24643649) has the molecular formula C24H34N4O3S2 and a molecular weight of 490.70 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-1-(5-methylthiophen-2-yl)sulfonylpiperidine-3-carboxamide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-1-(5-methylthiophen-2-yl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 24643649 |
| Molecular Formula | C24H34N4O3S2 |
| Molecular Weight | 490.70 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-1-(5-methylthiophen-2-yl)sulfonylpiperidine-3-carboxamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)C3CCCN(S(=O)(=O)c4ccc(C)s4)C3)cc2C)CC1 |
| InChI | InChI=1S/C24H34N4O3S2/c1-4-26-12-14-27(15-13-26)22-9-8-21(16-18(22)2)25-24(29)20-6-5-11-28(17-20)33(30,31)23-10-7-19(3)32-23/h7-10,16,20H,4-6,11-15,17H2,1-3H3,(H,25,29) |
| InChIKey | MSEKOMDRQCJWQR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.70 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|