C23H22ClN3O5S — CID 55811797
1-(benzenesulfonyl)-N-[4-chloro-2-(furan-2-carbonylamino)phenyl]piperidine-4-carboxamide (PubChem CID 55811797) has the molecular formula C23H22ClN3O5S and a molecular weight of 487.97 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-[4-chloro-2-(furan-2-carbonylamino)phenyl]piperidine-4-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-[4-chloro-2-(furan-2-carbonylamino)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55811797 |
| Molecular Formula | C23H22ClN3O5S |
| Molecular Weight | 487.97 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | 1-(benzenesulfonyl)-N-[4-chloro-2-(furan-2-carbonylamino)phenyl]piperidine-4-carboxamide |
| SMILES | O=C(Nc1cc(Cl)ccc1NC(=O)C1CCN(S(=O)(=O)c2ccccc2)CC1)c1ccco1 |
| InChI | InChI=1S/C23H22ClN3O5S/c24-17-8-9-19(20(15-17)26-23(29)21-7-4-14-32-21)25-22(28)16-10-12-27(13-11-16)33(30,31)18-5-2-1-3-6-18/h1-9,14-16H,10-13H2,(H,25,28)(H,26,29) |
| InChIKey | SFLBXWGUZSBODZ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.97 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |