C18H17ClF2N2O3S — CID 18170489
1-(4-chlorophenyl)sulfonyl-N-(2,5-difluorophenyl)piperidine-4-carboxamide (PubChem CID 18170489) has the molecular formula C18H17ClF2N2O3S and a molecular weight of 414.86 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-N-(2,5-difluorophenyl)piperidine-4-carboxamide.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-N-(2,5-difluorophenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 18170489 |
| Molecular Formula | C18H17ClF2N2O3S |
| Molecular Weight | 414.86 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-N-(2,5-difluorophenyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1cc(F)ccc1F)C1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C18H17ClF2N2O3S/c19-13-1-4-15(5-2-13)27(25,26)23-9-7-12(8-10-23)18(24)22-17-11-14(20)3-6-16(17)21/h1-6,11-12H,7-10H2,(H,22,24) |
| InChIKey | LUDJCTPCIMEYKB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.86 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |