C22H26F2N2O3S — CID 26681397
1-(4-tert-butylphenyl)sulfonyl-N-(2,4-difluorophenyl)piperidine-4-carboxamide (PubChem CID 26681397) has the molecular formula C22H26F2N2O3S and a molecular weight of 436.52 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)sulfonyl-N-(2,4-difluorophenyl)piperidine-4-carboxamide.
| Compound Name | 1-(4-tert-butylphenyl)sulfonyl-N-(2,4-difluorophenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 26681397 |
| Molecular Formula | C22H26F2N2O3S |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 1-(4-tert-butylphenyl)sulfonyl-N-(2,4-difluorophenyl)piperidine-4-carboxamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N2CCC(C(=O)Nc3ccc(F)cc3F)CC2)cc1 |
| InChI | InChI=1S/C22H26F2N2O3S/c1-22(2,3)16-4-7-18(8-5-16)30(28,29)26-12-10-15(11-13-26)21(27)25-20-9-6-17(23)14-19(20)24/h4-9,14-15H,10-13H2,1-3H3,(H,25,27) |
| InChIKey | NINICWZGUVOCNA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |