C17H16F2N2O3S — CID 1355774
N-(2,4-difluorophenyl)-4-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 1355774) has the molecular formula C17H16F2N2O3S and a molecular weight of 366.39 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-4-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | N-(2,4-difluorophenyl)-4-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 1355774 |
| Molecular Formula | C17H16F2N2O3S |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | N-(2,4-difluorophenyl)-4-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | O=C(Nc1ccc(F)cc1F)c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C17H16F2N2O3S/c18-13-5-8-16(15(19)11-13)20-17(22)12-3-6-14(7-4-12)25(23,24)21-9-1-2-10-21/h3-8,11H,1-2,9-10H2,(H,20,22) |
| InChIKey | KPMZFIRTMAOYAO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |