C19H20F2N2O4S — CID 2326591
N-(2,4-difluorophenyl)-4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonylbenzamide (PubChem CID 2326591) has the molecular formula C19H20F2N2O4S and a molecular weight of 410.44 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonylbenzamide.
| Compound Name | N-(2,4-difluorophenyl)-4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonylbenzamide |
|---|---|
| PubChem CID | 2326591 |
| Molecular Formula | C19H20F2N2O4S |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | N-(2,4-difluorophenyl)-4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonylbenzamide |
| SMILES | C[C@@H]1CN(S(=O)(=O)c2ccc(C(=O)Nc3ccc(F)cc3F)cc2)C[C@@H](C)O1 |
| InChI | InChI=1S/C19H20F2N2O4S/c1-12-10-23(11-13(2)27-12)28(25,26)16-6-3-14(4-7-16)19(24)22-18-8-5-15(20)9-17(18)21/h3-9,12-13H,10-11H2,1-2H3,(H,22,24)/t12-,13-/m1/s1 |
| InChIKey | UQOLMNSQHVHIPD-CHWSQXEVSA-N |
| XLogP | 3.02 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |