C19H19Cl3N2O4S — CID 42559699
4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonyl-N-(2,3,5-trichlorophenyl)benzamide (PubChem CID 42559699) has the molecular formula C19H19Cl3N2O4S and a molecular weight of 477.80 g/mol. Its IUPAC name is 4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonyl-N-(2,3,5-trichlorophenyl)benzamide.
| Compound Name | 4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonyl-N-(2,3,5-trichlorophenyl)benzamide |
|---|---|
| PubChem CID | 42559699 |
| Molecular Formula | C19H19Cl3N2O4S |
| Molecular Weight | 477.80 g/mol |
| Exact Mass | 476.01 |
| IUPAC Name | 4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonyl-N-(2,3,5-trichlorophenyl)benzamide |
| SMILES | C[C@H]1CN(S(=O)(=O)c2ccc(C(=O)Nc3cc(Cl)cc(Cl)c3Cl)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C19H19Cl3N2O4S/c1-11-9-24(10-12(2)28-11)29(26,27)15-5-3-13(4-6-15)19(25)23-17-8-14(20)7-16(21)18(17)22/h3-8,11-12H,9-10H2,1-2H3,(H,23,25)/t11-,12-/m0/s1 |
| InChIKey | ROLSESLHWKJOBC-RYUDHWBXSA-N |
| XLogP | 4.70 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.80 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|