C23H28ClN3O3S — CID 55885014
1-(benzenesulfonyl)-N-(3-chloro-4-piperidin-1-ylphenyl)piperidine-4-carboxamide (PubChem CID 55885014) has the molecular formula C23H28ClN3O3S and a molecular weight of 462.02 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-(3-chloro-4-piperidin-1-ylphenyl)piperidine-4-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-(3-chloro-4-piperidin-1-ylphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55885014 |
| Molecular Formula | C23H28ClN3O3S |
| Molecular Weight | 462.02 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | 1-(benzenesulfonyl)-N-(3-chloro-4-piperidin-1-ylphenyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCCC2)c(Cl)c1)C1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H28ClN3O3S/c24-21-17-19(9-10-22(21)26-13-5-2-6-14-26)25-23(28)18-11-15-27(16-12-18)31(29,30)20-7-3-1-4-8-20/h1,3-4,7-10,17-18H,2,5-6,11-16H2,(H,25,28) |
| InChIKey | DCZJXMIFCLYZHW-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.02 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|