C24H30FN3O4S — CID 55800460
1-(benzenesulfonyl)-N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]piperidine-4-carboxamide (PubChem CID 55800460) has the molecular formula C24H30FN3O4S and a molecular weight of 475.59 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]piperidine-4-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55800460 |
| Molecular Formula | C24H30FN3O4S |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 1-(benzenesulfonyl)-N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]piperidine-4-carboxamide |
| SMILES | CC1CN(c2ccc(NC(=O)C3CCN(S(=O)(=O)c4ccccc4)CC3)cc2F)CC(C)O1 |
| InChI | InChI=1S/C24H30FN3O4S/c1-17-15-27(16-18(2)32-17)23-9-8-20(14-22(23)25)26-24(29)19-10-12-28(13-11-19)33(30,31)21-6-4-3-5-7-21/h3-9,14,17-19H,10-13,15-16H2,1-2H3,(H,26,29) |
| InChIKey | ICFQEBQLRQDGRE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|