C22H34FN3O4S — CID 20630080
N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-4-(propan-2-ylsulfonylamino)cyclohexane-1-carboxamide (PubChem CID 20630080) has the molecular formula C22H34FN3O4S and a molecular weight of 455.60 g/mol. Its IUPAC name is N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-4-(propan-2-ylsulfonylamino)cyclohexane-1-carboxamide.
| Compound Name | N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-4-(propan-2-ylsulfonylamino)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 20630080 |
| Molecular Formula | C22H34FN3O4S |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | N-[4-(2,6-dimethylmorpholin-4-yl)-3-fluorophenyl]-4-(propan-2-ylsulfonylamino)cyclohexane-1-carboxamide |
| SMILES | CC1CN(c2ccc(NC(=O)C3CCC(NS(=O)(=O)C(C)C)CC3)cc2F)CC(C)O1 |
| InChI | InChI=1S/C22H34FN3O4S/c1-14(2)31(28,29)25-18-7-5-17(6-8-18)22(27)24-19-9-10-21(20(23)11-19)26-12-15(3)30-16(4)13-26/h9-11,14-18,25H,5-8,12-13H2,1-4H3,(H,24,27) |
| InChIKey | LNIYBCHSIUMCCO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|