C23H37N3O4S — CID 58958368
4-(butan-2-ylsulfonylamino)-N-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]phenyl]cyclohexane-1-carboxamide (PubChem CID 58958368) has the molecular formula C23H37N3O4S and a molecular weight of 451.63 g/mol. Its IUPAC name is 4-(butan-2-ylsulfonylamino)-N-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]phenyl]cyclohexane-1-carboxamide.
| Compound Name | 4-(butan-2-ylsulfonylamino)-N-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]phenyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 58958368 |
| Molecular Formula | C23H37N3O4S |
| Molecular Weight | 451.63 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | 4-(butan-2-ylsulfonylamino)-N-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]phenyl]cyclohexane-1-carboxamide |
| SMILES | CCC(C)S(=O)(=O)NC1CCC(C(=O)Nc2ccc(N3C[C@@H](C)O[C@@H](C)C3)cc2)CC1 |
| InChI | InChI=1S/C23H37N3O4S/c1-5-18(4)31(28,29)25-21-8-6-19(7-9-21)23(27)24-20-10-12-22(13-11-20)26-14-16(2)30-17(3)15-26/h10-13,16-19,21,25H,5-9,14-15H2,1-4H3,(H,24,27)/t16-,17+,18?,19?,21? |
| InChIKey | IWIJQKHDDIPHHE-BZQJJPTISA-N |
| XLogP | 3.52 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.63 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|