C25H41N3O4S — CID 59582609
N-[4-[(2S)-2,6-dimethylmorpholin-4-yl]phenyl]-4-(hexan-2-ylsulfonylamino)cyclohexane-1-carboxamide (PubChem CID 59582609) has the molecular formula C25H41N3O4S and a molecular weight of 479.69 g/mol. Its IUPAC name is N-[4-[(2S)-2,6-dimethylmorpholin-4-yl]phenyl]-4-(hexan-2-ylsulfonylamino)cyclohexane-1-carboxamide.
| Compound Name | N-[4-[(2S)-2,6-dimethylmorpholin-4-yl]phenyl]-4-(hexan-2-ylsulfonylamino)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 59582609 |
| Molecular Formula | C25H41N3O4S |
| Molecular Weight | 479.69 g/mol |
| Exact Mass | 479.28 |
| IUPAC Name | N-[4-[(2S)-2,6-dimethylmorpholin-4-yl]phenyl]-4-(hexan-2-ylsulfonylamino)cyclohexane-1-carboxamide |
| SMILES | CCCCC(C)S(=O)(=O)NC1CCC(C(=O)Nc2ccc(N3CC(C)O[C@@H](C)C3)cc2)CC1 |
| InChI | InChI=1S/C25H41N3O4S/c1-5-6-7-20(4)33(30,31)27-23-10-8-21(9-11-23)25(29)26-22-12-14-24(15-13-22)28-16-18(2)32-19(3)17-28/h12-15,18-21,23,27H,5-11,16-17H2,1-4H3,(H,26,29)/t18-,19?,20?,21?,23?/m0/s1 |
| InChIKey | FXEIVPIGOOBHHE-OBHCEDRKSA-N |
| XLogP | 4.30 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.69 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|