C19H31N3O4S — CID 20630803
N-(6-butoxy-3-pyridinyl)-4-(propan-2-ylsulfonylamino)cyclohexane-1-carboxamide (PubChem CID 20630803) has the molecular formula C19H31N3O4S and a molecular weight of 397.54 g/mol. Its IUPAC name is N-(6-butoxy-3-pyridinyl)-4-(propan-2-ylsulfonylamino)cyclohexane-1-carboxamide.
| Compound Name | N-(6-butoxy-3-pyridinyl)-4-(propan-2-ylsulfonylamino)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 20630803 |
| Molecular Formula | C19H31N3O4S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | N-(6-butoxy-3-pyridinyl)-4-(propan-2-ylsulfonylamino)cyclohexane-1-carboxamide |
| SMILES | CCCCOc1ccc(NC(=O)C2CCC(NS(=O)(=O)C(C)C)CC2)cn1 |
| InChI | InChI=1S/C19H31N3O4S/c1-4-5-12-26-18-11-10-17(13-20-18)21-19(23)15-6-8-16(9-7-15)22-27(24,25)14(2)3/h10-11,13-16,22H,4-9,12H2,1-3H3,(H,21,23) |
| InChIKey | VHJBZDLUYZHTTI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|