C22H36N2O4 — CID 14304482
dodecanoic acid;N-(6-methoxy-3-pyridinyl)cyclopropanecarboxamide (PubChem CID 14304482) has the molecular formula C22H36N2O4 and a molecular weight of 392.54 g/mol. Its IUPAC name is dodecanoic acid;N-(6-methoxy-3-pyridinyl)cyclopropanecarboxamide.
| Compound Name | dodecanoic acid;N-(6-methoxy-3-pyridinyl)cyclopropanecarboxamide |
|---|---|
| PubChem CID | 14304482 |
| Molecular Formula | C22H36N2O4 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | dodecanoic acid;N-(6-methoxy-3-pyridinyl)cyclopropanecarboxamide |
| SMILES | CCCCCCCCCCCC(=O)O.COc1ccc(NC(=O)C2CC2)cn1 |
| InChI | InChI=1S/C12H24O2.C10H12N2O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;1-14-9-5-4-8(6-11-9)12-10(13)7-2-3-7/h2-11H2,1H3,(H,13,14);4-7H,2-3H2,1H3,(H,12,13) |
| InChIKey | CWWXKUHOHSBFFZ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|