C22H26Cl2N4O3S — CID 38705262
N-(5-chloro-2-piperidin-1-ylphenyl)-1-[(2-chloro-3-pyridinyl)sulfonyl]piperidine-4-carboxamide (PubChem CID 38705262) has the molecular formula C22H26Cl2N4O3S and a molecular weight of 497.45 g/mol. Its IUPAC name is N-(5-chloro-2-piperidin-1-ylphenyl)-1-[(2-chloro-3-pyridinyl)sulfonyl]piperidine-4-carboxamide.
| Compound Name | N-(5-chloro-2-piperidin-1-ylphenyl)-1-[(2-chloro-3-pyridinyl)sulfonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 38705262 |
| Molecular Formula | C22H26Cl2N4O3S |
| Molecular Weight | 497.45 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | N-(5-chloro-2-piperidin-1-ylphenyl)-1-[(2-chloro-3-pyridinyl)sulfonyl]piperidine-4-carboxamide |
| SMILES | O=C(Nc1cc(Cl)ccc1N1CCCCC1)C1CCN(S(=O)(=O)c2cccnc2Cl)CC1 |
| InChI | InChI=1S/C22H26Cl2N4O3S/c23-17-6-7-19(27-11-2-1-3-12-27)18(15-17)26-22(29)16-8-13-28(14-9-16)32(30,31)20-5-4-10-25-21(20)24/h4-7,10,15-16H,1-3,8-9,11-14H2,(H,26,29) |
| InChIKey | BOGJMMVEDXMEHI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.45 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|