C18H16ClF2N3O5S — CID 34312301
1-[(2-chloro-3-pyridinyl)sulfonyl]-N-(2,2-difluoro-1,3-benzodioxol-5-yl)piperidine-4-carboxamide (PubChem CID 34312301) has the molecular formula C18H16ClF2N3O5S and a molecular weight of 459.86 g/mol. Its IUPAC name is 1-[(2-chloro-3-pyridinyl)sulfonyl]-N-(2,2-difluoro-1,3-benzodioxol-5-yl)piperidine-4-carboxamide.
| Compound Name | 1-[(2-chloro-3-pyridinyl)sulfonyl]-N-(2,2-difluoro-1,3-benzodioxol-5-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 34312301 |
| Molecular Formula | C18H16ClF2N3O5S |
| Molecular Weight | 459.86 g/mol |
| Exact Mass | 459.05 |
| IUPAC Name | 1-[(2-chloro-3-pyridinyl)sulfonyl]-N-(2,2-difluoro-1,3-benzodioxol-5-yl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OC(F)(F)O2)C1CCN(S(=O)(=O)c2cccnc2Cl)CC1 |
| InChI | InChI=1S/C18H16ClF2N3O5S/c19-16-15(2-1-7-22-16)30(26,27)24-8-5-11(6-9-24)17(25)23-12-3-4-13-14(10-12)29-18(20,21)28-13/h1-4,7,10-11H,5-6,8-9H2,(H,23,25) |
| InChIKey | RKTOOURHDPOGHI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.86 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|