C18H19Cl2N3O3S — CID 31079598
N-(5-chloro-2-methylphenyl)-1-[(2-chloro-3-pyridinyl)sulfonyl]piperidine-4-carboxamide (PubChem CID 31079598) has the molecular formula C18H19Cl2N3O3S and a molecular weight of 428.34 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-1-[(2-chloro-3-pyridinyl)sulfonyl]piperidine-4-carboxamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-1-[(2-chloro-3-pyridinyl)sulfonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 31079598 |
| Molecular Formula | C18H19Cl2N3O3S |
| Molecular Weight | 428.34 g/mol |
| Exact Mass | 427.05 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-1-[(2-chloro-3-pyridinyl)sulfonyl]piperidine-4-carboxamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)C1CCN(S(=O)(=O)c2cccnc2Cl)CC1 |
| InChI | InChI=1S/C18H19Cl2N3O3S/c1-12-4-5-14(19)11-15(12)22-18(24)13-6-9-23(10-7-13)27(25,26)16-3-2-8-21-17(16)20/h2-5,8,11,13H,6-7,9-10H2,1H3,(H,22,24) |
| InChIKey | NSOZNPLBNKUDLF-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|