C18H25ClN4O4S — CID 55511990
1-[(2-chloro-3-pyridinyl)sulfonyl]-N-(3-oxo-3-pyrrolidin-1-ylpropyl)piperidine-4-carboxamide (PubChem CID 55511990) has the molecular formula C18H25ClN4O4S and a molecular weight of 428.94 g/mol. Its IUPAC name is 1-[(2-chloro-3-pyridinyl)sulfonyl]-N-(3-oxo-3-pyrrolidin-1-ylpropyl)piperidine-4-carboxamide.
| Compound Name | 1-[(2-chloro-3-pyridinyl)sulfonyl]-N-(3-oxo-3-pyrrolidin-1-ylpropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55511990 |
| Molecular Formula | C18H25ClN4O4S |
| Molecular Weight | 428.94 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 1-[(2-chloro-3-pyridinyl)sulfonyl]-N-(3-oxo-3-pyrrolidin-1-ylpropyl)piperidine-4-carboxamide |
| SMILES | O=C(NCCC(=O)N1CCCC1)C1CCN(S(=O)(=O)c2cccnc2Cl)CC1 |
| InChI | InChI=1S/C18H25ClN4O4S/c19-17-15(4-3-8-20-17)28(26,27)23-12-6-14(7-13-23)18(25)21-9-5-16(24)22-10-1-2-11-22/h3-4,8,14H,1-2,5-7,9-13H2,(H,21,25) |
| InChIKey | WLJWXTUZMPAXTO-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.94 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|