C22H28ClN5O3S — CID 55859758
1-[(2-chloro-3-pyridinyl)sulfonyl]-N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]piperidine-4-carboxamide (PubChem CID 55859758) has the molecular formula C22H28ClN5O3S and a molecular weight of 478.02 g/mol. Its IUPAC name is 1-[(2-chloro-3-pyridinyl)sulfonyl]-N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]piperidine-4-carboxamide.
| Compound Name | 1-[(2-chloro-3-pyridinyl)sulfonyl]-N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55859758 |
| Molecular Formula | C22H28ClN5O3S |
| Molecular Weight | 478.02 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | 1-[(2-chloro-3-pyridinyl)sulfonyl]-N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]piperidine-4-carboxamide |
| SMILES | O=C(NC1CCN(Cc2ccccn2)CC1)C1CCN(S(=O)(=O)c2cccnc2Cl)CC1 |
| InChI | InChI=1S/C22H28ClN5O3S/c23-21-20(5-3-11-25-21)32(30,31)28-14-6-17(7-15-28)22(29)26-18-8-12-27(13-9-18)16-19-4-1-2-10-24-19/h1-5,10-11,17-18H,6-9,12-16H2,(H,26,29) |
| InChIKey | YDHAFIKCLMADMS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.02 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|