C12H20Cl2N4O — CID 174440638
[1-(pyridin-2-ylmethyl)piperidin-4-yl]urea;dihydrochloride (PubChem CID 174440638) has the molecular formula C12H20Cl2N4O and a molecular weight of 307.22 g/mol. Its IUPAC name is [1-(pyridin-2-ylmethyl)piperidin-4-yl]urea;dihydrochloride.
| Compound Name | [1-(pyridin-2-ylmethyl)piperidin-4-yl]urea;dihydrochloride |
|---|---|
| PubChem CID | 174440638 |
| Molecular Formula | C12H20Cl2N4O |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | [1-(pyridin-2-ylmethyl)piperidin-4-yl]urea;dihydrochloride |
| SMILES | Cl.Cl.NC(=O)NC1CCN(Cc2ccccn2)CC1 |
| InChI | InChI=1S/C12H18N4O.2ClH/c13-12(17)15-10-4-7-16(8-5-10)9-11-3-1-2-6-14-11;;/h1-3,6,10H,4-5,7-9H2,(H3,13,15,17);2*1H |
| InChIKey | ZHGAGYHBHCAYJG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |