C19H28N4O — CID 119901353
3-amino-N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 119901353) has the molecular formula C19H28N4O and a molecular weight of 328.46 g/mol. Its IUPAC name is 3-amino-N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | 3-amino-N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 119901353 |
| Molecular Formula | C19H28N4O |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | 3-amino-N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | NC1C2CCC(C2)C1C(=O)NC1CCN(Cc2ccccn2)CC1 |
| InChI | InChI=1S/C19H28N4O/c20-18-14-5-4-13(11-14)17(18)19(24)22-15-6-9-23(10-7-15)12-16-3-1-2-8-21-16/h1-3,8,13-15,17-18H,4-7,9-12,20H2,(H,22,24) |
| InChIKey | QEPIYSWGBLQRCM-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |