C18H19Cl2N3O — CID 47058964
2,4-dichloro-N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]benzamide (PubChem CID 47058964) has the molecular formula C18H19Cl2N3O and a molecular weight of 364.28 g/mol. Its IUPAC name is 2,4-dichloro-N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 47058964 |
| Molecular Formula | C18H19Cl2N3O |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 2,4-dichloro-N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]benzamide |
| SMILES | O=C(NC1CCN(Cc2ccccn2)CC1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H19Cl2N3O/c19-13-4-5-16(17(20)11-13)18(24)22-14-6-9-23(10-7-14)12-15-3-1-2-8-21-15/h1-5,8,11,14H,6-7,9-10,12H2,(H,22,24) |
| InChIKey | HAUZEROVTILWJN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |