C17H17Cl2N3O — CID 166287246
2,3-dichloro-N-[(3R)-1-(pyridin-2-ylmethyl)pyrrolidin-3-yl]benzamide (PubChem CID 166287246) has the molecular formula C17H17Cl2N3O and a molecular weight of 350.25 g/mol. Its IUPAC name is 2,3-dichloro-N-[(3R)-1-(pyridin-2-ylmethyl)pyrrolidin-3-yl]benzamide.
| Compound Name | 2,3-dichloro-N-[(3R)-1-(pyridin-2-ylmethyl)pyrrolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 166287246 |
| Molecular Formula | C17H17Cl2N3O |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 2,3-dichloro-N-[(3R)-1-(pyridin-2-ylmethyl)pyrrolidin-3-yl]benzamide |
| SMILES | O=C(N[C@@H]1CCN(Cc2ccccn2)C1)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C17H17Cl2N3O/c18-15-6-3-5-14(16(15)19)17(23)21-13-7-9-22(11-13)10-12-4-1-2-8-20-12/h1-6,8,13H,7,9-11H2,(H,21,23)/t13-/m1/s1 |
| InChIKey | VWXIHYJDLMHLIJ-CYBMUJFWSA-N |
| XLogP | 3.39 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |