C21H19Cl2N3O — CID 24831481
2,3-dichloro-N-(1-isoquinolin-1-ylpiperidin-4-yl)benzamide (PubChem CID 24831481) has the molecular formula C21H19Cl2N3O and a molecular weight of 400.31 g/mol. Its IUPAC name is 2,3-dichloro-N-(1-isoquinolin-1-ylpiperidin-4-yl)benzamide.
| Compound Name | 2,3-dichloro-N-(1-isoquinolin-1-ylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 24831481 |
| Molecular Formula | C21H19Cl2N3O |
| Molecular Weight | 400.31 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 2,3-dichloro-N-(1-isoquinolin-1-ylpiperidin-4-yl)benzamide |
| SMILES | O=C(NC1CCN(c2nccc3ccccc23)CC1)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C21H19Cl2N3O/c22-18-7-3-6-17(19(18)23)21(27)25-15-9-12-26(13-10-15)20-16-5-2-1-4-14(16)8-11-24-20/h1-8,11,15H,9-10,12-13H2,(H,25,27) |
| InChIKey | PQWKGDCQGBBBOU-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.31 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |