C29H25Cl2N3O — CID 87610883
benzene;2,3-dichloro-N-[1-(3-ethynylisoquinolin-1-yl)piperidin-4-yl]benzamide (PubChem CID 87610883) has the molecular formula C29H25Cl2N3O and a molecular weight of 502.45 g/mol. Its IUPAC name is benzene;2,3-dichloro-N-[1-(3-ethynylisoquinolin-1-yl)piperidin-4-yl]benzamide.
| Compound Name | benzene;2,3-dichloro-N-[1-(3-ethynylisoquinolin-1-yl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 87610883 |
| Molecular Formula | C29H25Cl2N3O |
| Molecular Weight | 502.45 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | benzene;2,3-dichloro-N-[1-(3-ethynylisoquinolin-1-yl)piperidin-4-yl]benzamide |
| SMILES | C#Cc1cc2ccccc2c(N2CCC(NC(=O)c3cccc(Cl)c3Cl)CC2)n1.c1ccccc1 |
| InChI | InChI=1S/C23H19Cl2N3O.C6H6/c1-2-16-14-15-6-3-4-7-18(15)22(26-16)28-12-10-17(11-13-28)27-23(29)19-8-5-9-20(24)21(19)25;1-2-4-6-5-3-1/h1,3-9,14,17H,10-13H2,(H,27,29);1-6H |
| InChIKey | SEQNLGQSNDCDSX-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.45 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|