C26H23Cl2N5O — CID 68879453
N-[1-(7-anilinoquinazolin-4-yl)piperidin-4-yl]-2,3-dichlorobenzamide (PubChem CID 68879453) has the molecular formula C26H23Cl2N5O and a molecular weight of 492.41 g/mol. Its IUPAC name is N-[1-(7-anilinoquinazolin-4-yl)piperidin-4-yl]-2,3-dichlorobenzamide.
| Compound Name | N-[1-(7-anilinoquinazolin-4-yl)piperidin-4-yl]-2,3-dichlorobenzamide |
|---|---|
| PubChem CID | 68879453 |
| Molecular Formula | C26H23Cl2N5O |
| Molecular Weight | 492.41 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | N-[1-(7-anilinoquinazolin-4-yl)piperidin-4-yl]-2,3-dichlorobenzamide |
| SMILES | O=C(NC1CCN(c2ncnc3cc(Nc4ccccc4)ccc23)CC1)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C26H23Cl2N5O/c27-22-8-4-7-21(24(22)28)26(34)32-18-11-13-33(14-12-18)25-20-10-9-19(15-23(20)29-16-30-25)31-17-5-2-1-3-6-17/h1-10,15-16,18,31H,11-14H2,(H,32,34) |
| InChIKey | WXNLLSHVYNULGD-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.41 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |