C19H19ClN4O2 — CID 86884110
N-[1-(7-chloroquinazolin-4-yl)piperidin-4-yl]-2-methylfuran-3-carboxamide (PubChem CID 86884110) has the molecular formula C19H19ClN4O2 and a molecular weight of 370.84 g/mol. Its IUPAC name is N-[1-(7-chloroquinazolin-4-yl)piperidin-4-yl]-2-methylfuran-3-carboxamide.
| Compound Name | N-[1-(7-chloroquinazolin-4-yl)piperidin-4-yl]-2-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 86884110 |
| Molecular Formula | C19H19ClN4O2 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | N-[1-(7-chloroquinazolin-4-yl)piperidin-4-yl]-2-methylfuran-3-carboxamide |
| SMILES | Cc1occc1C(=O)NC1CCN(c2ncnc3cc(Cl)ccc23)CC1 |
| InChI | InChI=1S/C19H19ClN4O2/c1-12-15(6-9-26-12)19(25)23-14-4-7-24(8-5-14)18-16-3-2-13(20)10-17(16)21-11-22-18/h2-3,6,9-11,14H,4-5,7-8H2,1H3,(H,23,25) |
| InChIKey | CJLBVRUNGJTFCH-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |