C20H17ClF2N4O — CID 24829708
N-[1-(7-chloroquinazolin-4-yl)piperidin-4-yl]-3,4-difluorobenzamide (PubChem CID 24829708) has the molecular formula C20H17ClF2N4O and a molecular weight of 402.83 g/mol. Its IUPAC name is N-[1-(7-chloroquinazolin-4-yl)piperidin-4-yl]-3,4-difluorobenzamide.
| Compound Name | N-[1-(7-chloroquinazolin-4-yl)piperidin-4-yl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 24829708 |
| Molecular Formula | C20H17ClF2N4O |
| Molecular Weight | 402.83 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | N-[1-(7-chloroquinazolin-4-yl)piperidin-4-yl]-3,4-difluorobenzamide |
| SMILES | O=C(NC1CCN(c2ncnc3cc(Cl)ccc23)CC1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H17ClF2N4O/c21-13-2-3-15-18(10-13)24-11-25-19(15)27-7-5-14(6-8-27)26-20(28)12-1-4-16(22)17(23)9-12/h1-4,9-11,14H,5-8H2,(H,26,28) |
| InChIKey | FQVWQRTWLYDPKJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.83 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |