C18H17ClN4OS — CID 86839632
N-[1-(7-chloroquinazolin-4-yl)piperidin-4-yl]thiophene-3-carboxamide (PubChem CID 86839632) has the molecular formula C18H17ClN4OS and a molecular weight of 372.88 g/mol. Its IUPAC name is N-[1-(7-chloroquinazolin-4-yl)piperidin-4-yl]thiophene-3-carboxamide.
| Compound Name | N-[1-(7-chloroquinazolin-4-yl)piperidin-4-yl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 86839632 |
| Molecular Formula | C18H17ClN4OS |
| Molecular Weight | 372.88 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | N-[1-(7-chloroquinazolin-4-yl)piperidin-4-yl]thiophene-3-carboxamide |
| SMILES | O=C(NC1CCN(c2ncnc3cc(Cl)ccc23)CC1)c1ccsc1 |
| InChI | InChI=1S/C18H17ClN4OS/c19-13-1-2-15-16(9-13)20-11-21-17(15)23-6-3-14(4-7-23)22-18(24)12-5-8-25-10-12/h1-2,5,8-11,14H,3-4,6-7H2,(H,22,24) |
| InChIKey | VFHDQECNBIJYPQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.88 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |