C20H17Cl2N5O3 — CID 24830041
2-chloro-N-[1-(7-chloroquinazolin-4-yl)piperidin-4-yl]-4-nitrobenzamide (PubChem CID 24830041) has the molecular formula C20H17Cl2N5O3 and a molecular weight of 446.29 g/mol. Its IUPAC name is 2-chloro-N-[1-(7-chloroquinazolin-4-yl)piperidin-4-yl]-4-nitrobenzamide.
| Compound Name | 2-chloro-N-[1-(7-chloroquinazolin-4-yl)piperidin-4-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 24830041 |
| Molecular Formula | C20H17Cl2N5O3 |
| Molecular Weight | 446.29 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | 2-chloro-N-[1-(7-chloroquinazolin-4-yl)piperidin-4-yl]-4-nitrobenzamide |
| SMILES | O=C(NC1CCN(c2ncnc3cc(Cl)ccc23)CC1)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C20H17Cl2N5O3/c21-12-1-3-16-18(9-12)23-11-24-19(16)26-7-5-13(6-8-26)25-20(28)15-4-2-14(27(29)30)10-17(15)22/h1-4,9-11,13H,5-8H2,(H,25,28) |
| InChIKey | CUWKFBLJWJDWQY-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 101.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.29 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|