C28H24Cl2N4O3 — CID 68879918
methyl 4-[4-[4-[(2,3-dichlorobenzoyl)amino]piperidin-1-yl]quinazolin-7-yl]benzoate (PubChem CID 68879918) has the molecular formula C28H24Cl2N4O3 and a molecular weight of 535.43 g/mol. Its IUPAC name is methyl 4-[4-[4-[(2,3-dichlorobenzoyl)amino]piperidin-1-yl]quinazolin-7-yl]benzoate.
| Compound Name | methyl 4-[4-[4-[(2,3-dichlorobenzoyl)amino]piperidin-1-yl]quinazolin-7-yl]benzoate |
|---|---|
| PubChem CID | 68879918 |
| Molecular Formula | C28H24Cl2N4O3 |
| Molecular Weight | 535.43 g/mol |
| Exact Mass | 534.12 |
| IUPAC Name | methyl 4-[4-[4-[(2,3-dichlorobenzoyl)amino]piperidin-1-yl]quinazolin-7-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2ccc3c(N4CCC(NC(=O)c5cccc(Cl)c5Cl)CC4)ncnc3c2)cc1 |
| InChI | InChI=1S/C28H24Cl2N4O3/c1-37-28(36)18-7-5-17(6-8-18)19-9-10-21-24(15-19)31-16-32-26(21)34-13-11-20(12-14-34)33-27(35)22-3-2-4-23(29)25(22)30/h2-10,15-16,20H,11-14H2,1H3,(H,33,35) |
| InChIKey | PHNDRLBYJCOHHQ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.43 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |