C22H18Cl2N4O — CID 68879436
2,3-dichloro-N-[1-(6-cyanoisoquinolin-1-yl)piperidin-4-yl]benzamide (PubChem CID 68879436) has the molecular formula C22H18Cl2N4O and a molecular weight of 425.32 g/mol. Its IUPAC name is 2,3-dichloro-N-[1-(6-cyanoisoquinolin-1-yl)piperidin-4-yl]benzamide.
| Compound Name | 2,3-dichloro-N-[1-(6-cyanoisoquinolin-1-yl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 68879436 |
| Molecular Formula | C22H18Cl2N4O |
| Molecular Weight | 425.32 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 2,3-dichloro-N-[1-(6-cyanoisoquinolin-1-yl)piperidin-4-yl]benzamide |
| SMILES | N#Cc1ccc2c(N3CCC(NC(=O)c4cccc(Cl)c4Cl)CC3)nccc2c1 |
| InChI | InChI=1S/C22H18Cl2N4O/c23-19-3-1-2-18(20(19)24)22(29)27-16-7-10-28(11-8-16)21-17-5-4-14(13-25)12-15(17)6-9-26-21/h1-6,9,12,16H,7-8,10-11H2,(H,27,29) |
| InChIKey | MMBVWILNUPJJRQ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.32 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |