C29H23Cl2N3O — CID 24831638
2,3-dichloro-N-[1-[7-(2-phenylethynyl)quinolin-4-yl]piperidin-4-yl]benzamide (PubChem CID 24831638) has the molecular formula C29H23Cl2N3O and a molecular weight of 500.43 g/mol. Its IUPAC name is 2,3-dichloro-N-[1-[7-(2-phenylethynyl)quinolin-4-yl]piperidin-4-yl]benzamide.
| Compound Name | 2,3-dichloro-N-[1-[7-(2-phenylethynyl)quinolin-4-yl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 24831638 |
| Molecular Formula | C29H23Cl2N3O |
| Molecular Weight | 500.43 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | 2,3-dichloro-N-[1-[7-(2-phenylethynyl)quinolin-4-yl]piperidin-4-yl]benzamide |
| SMILES | O=C(NC1CCN(c2ccnc3cc(C#Cc4ccccc4)ccc23)CC1)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C29H23Cl2N3O/c30-25-8-4-7-24(28(25)31)29(35)33-22-14-17-34(18-15-22)27-13-16-32-26-19-21(11-12-23(26)27)10-9-20-5-2-1-3-6-20/h1-8,11-13,16,19,22H,14-15,17-18H2,(H,33,35) |
| InChIKey | RWNIAQDVNOLWOS-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.43 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|