C20H17Cl3N4O — CID 24830996
2,5-dichloro-N-[1-(7-chloroquinolin-4-yl)piperidin-4-yl]pyridine-3-carboxamide (PubChem CID 24830996) has the molecular formula C20H17Cl3N4O and a molecular weight of 435.74 g/mol. Its IUPAC name is 2,5-dichloro-N-[1-(7-chloroquinolin-4-yl)piperidin-4-yl]pyridine-3-carboxamide.
| Compound Name | 2,5-dichloro-N-[1-(7-chloroquinolin-4-yl)piperidin-4-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 24830996 |
| Molecular Formula | C20H17Cl3N4O |
| Molecular Weight | 435.74 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | 2,5-dichloro-N-[1-(7-chloroquinolin-4-yl)piperidin-4-yl]pyridine-3-carboxamide |
| SMILES | O=C(NC1CCN(c2ccnc3cc(Cl)ccc23)CC1)c1cc(Cl)cnc1Cl |
| InChI | InChI=1S/C20H17Cl3N4O/c21-12-1-2-15-17(10-12)24-6-3-18(15)27-7-4-14(5-8-27)26-20(28)16-9-13(22)11-25-19(16)23/h1-3,6,9-11,14H,4-5,7-8H2,(H,26,28) |
| InChIKey | MEDPJHMJRLWFQX-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.74 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|