C57H58Cl4N10O2 — CID 10748618
1,9-bis[4,7-bis(7-chloroquinolin-4-yl)-1,4,7-triazonan-1-yl]nonane-1,9-dione (PubChem CID 10748618) has the molecular formula C57H58Cl4N10O2 and a molecular weight of 1056.97 g/mol. Its IUPAC name is 1,9-bis[4,7-bis(7-chloroquinolin-4-yl)-1,4,7-triazonan-1-yl]nonane-1,9-dione.
| Compound Name | 1,9-bis[4,7-bis(7-chloroquinolin-4-yl)-1,4,7-triazonan-1-yl]nonane-1,9-dione |
|---|---|
| PubChem CID | 10748618 |
| Molecular Formula | C57H58Cl4N10O2 |
| Molecular Weight | 1056.97 g/mol |
| Exact Mass | 1054.35 |
| IUPAC Name | 1,9-bis[4,7-bis(7-chloroquinolin-4-yl)-1,4,7-triazonan-1-yl]nonane-1,9-dione |
| SMILES | O=C(CCCCCCCC(=O)N1CCN(c2ccnc3cc(Cl)ccc23)CCN(c2ccnc3cc(Cl)ccc23)CC1)N1CCN(c2ccnc3cc(Cl)ccc23)CCN(c2ccnc3cc(Cl)ccc23)CC1 |
| InChI | InChI=1S/C57H58Cl4N10O2/c58-40-8-12-44-48(36-40)62-20-16-52(44)66-24-25-67(53-17-21-63-49-37-41(59)9-13-45(49)53)29-33-70(32-28-66)56(72)6-4-2-1-3-5-7-57(73)71-34-30-68(54-18-22-64-50-38-42(60)10-14-46(50)54)26-27-69(31-35-71)55-19-23-65-51-39-43(61)11-15-47(51)55/h8-23,36-39H,1-7,24-35H2 |
| InChIKey | SCCBAVOQRANXKK-UHFFFAOYSA-N |
| XLogP | 12.23 |
| TPSA | 105.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1056.97 |
| LogP ≤ 5 | 12.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|