C32H36Cl2N6O — CID 10438408
1-[4,7-bis(7-chloroquinolin-4-yl)-1,4,7-triazonan-1-yl]-3-piperidin-1-ylpropan-1-one (PubChem CID 10438408) has the molecular formula C32H36Cl2N6O and a molecular weight of 591.59 g/mol. Its IUPAC name is 1-[4,7-bis(7-chloroquinolin-4-yl)-1,4,7-triazonan-1-yl]-3-piperidin-1-ylpropan-1-one.
| Compound Name | 1-[4,7-bis(7-chloroquinolin-4-yl)-1,4,7-triazonan-1-yl]-3-piperidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 10438408 |
| Molecular Formula | C32H36Cl2N6O |
| Molecular Weight | 591.59 g/mol |
| Exact Mass | 590.23 |
| IUPAC Name | 1-[4,7-bis(7-chloroquinolin-4-yl)-1,4,7-triazonan-1-yl]-3-piperidin-1-ylpropan-1-one |
| SMILES | O=C(CCN1CCCCC1)N1CCN(c2ccnc3cc(Cl)ccc23)CCN(c2ccnc3cc(Cl)ccc23)CC1 |
| InChI | InChI=1S/C32H36Cl2N6O/c33-24-4-6-26-28(22-24)35-11-8-30(26)38-16-17-39(31-9-12-36-29-23-25(34)5-7-27(29)31)19-21-40(20-18-38)32(41)10-15-37-13-2-1-3-14-37/h4-9,11-12,22-23H,1-3,10,13-21H2 |
| InChIKey | FZWBQCHFFBIVSI-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 55.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.59 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |