C18H22ClN3O2 — CID 133346351
ethyl 2-[4-(7-chloroquinolin-4-yl)-1,4-diazepan-1-yl]acetate (PubChem CID 133346351) has the molecular formula C18H22ClN3O2 and a molecular weight of 347.85 g/mol. Its IUPAC name is ethyl 2-[4-(7-chloroquinolin-4-yl)-1,4-diazepan-1-yl]acetate.
| Compound Name | ethyl 2-[4-(7-chloroquinolin-4-yl)-1,4-diazepan-1-yl]acetate |
|---|---|
| PubChem CID | 133346351 |
| Molecular Formula | C18H22ClN3O2 |
| Molecular Weight | 347.85 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | ethyl 2-[4-(7-chloroquinolin-4-yl)-1,4-diazepan-1-yl]acetate |
| SMILES | CCOC(=O)CN1CCCN(c2ccnc3cc(Cl)ccc23)CC1 |
| InChI | InChI=1S/C18H22ClN3O2/c1-2-24-18(23)13-21-8-3-9-22(11-10-21)17-6-7-20-16-12-14(19)4-5-15(16)17/h4-7,12H,2-3,8-11,13H2,1H3 |
| InChIKey | FNFWEUINMVXTEK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.85 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |