C16H18ClN3O2 — CID 133333942
methyl 2-[4-(6-chloroquinolin-4-yl)piperazin-1-yl]acetate (PubChem CID 133333942) has the molecular formula C16H18ClN3O2 and a molecular weight of 319.79 g/mol. Its IUPAC name is methyl 2-[4-(6-chloroquinolin-4-yl)piperazin-1-yl]acetate.
| Compound Name | methyl 2-[4-(6-chloroquinolin-4-yl)piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 133333942 |
| Molecular Formula | C16H18ClN3O2 |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | methyl 2-[4-(6-chloroquinolin-4-yl)piperazin-1-yl]acetate |
| SMILES | COC(=O)CN1CCN(c2ccnc3ccc(Cl)cc23)CC1 |
| InChI | InChI=1S/C16H18ClN3O2/c1-22-16(21)11-19-6-8-20(9-7-19)15-4-5-18-14-3-2-12(17)10-13(14)15/h2-5,10H,6-9,11H2,1H3 |
| InChIKey | HHRUWGGHKDZICP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |