C21H29ClN4O — CID 134130907
1-[4-(7-chloroquinolin-4-yl)piperazin-1-yl]-2-(dipropylamino)ethanone (PubChem CID 134130907) has the molecular formula C21H29ClN4O and a molecular weight of 388.94 g/mol. Its IUPAC name is 1-[4-(7-chloroquinolin-4-yl)piperazin-1-yl]-2-(dipropylamino)ethanone.
| Compound Name | 1-[4-(7-chloroquinolin-4-yl)piperazin-1-yl]-2-(dipropylamino)ethanone |
|---|---|
| PubChem CID | 134130907 |
| Molecular Formula | C21H29ClN4O |
| Molecular Weight | 388.94 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 1-[4-(7-chloroquinolin-4-yl)piperazin-1-yl]-2-(dipropylamino)ethanone |
| SMILES | CCCN(CCC)CC(=O)N1CCN(c2ccnc3cc(Cl)ccc23)CC1 |
| InChI | InChI=1S/C21H29ClN4O/c1-3-9-24(10-4-2)16-21(27)26-13-11-25(12-14-26)20-7-8-23-19-15-17(22)5-6-18(19)20/h5-8,15H,3-4,9-14,16H2,1-2H3 |
| InChIKey | MGXXDRQALNSMSR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.94 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |