C29H29Cl2N5O3 — CID 10816810
5-[4,7-bis(7-chloroquinolin-4-yl)-1,4,7-triazonan-1-yl]-5-oxopentanoic acid (PubChem CID 10816810) has the molecular formula C29H29Cl2N5O3 and a molecular weight of 566.49 g/mol. Its IUPAC name is 5-[4,7-bis(7-chloroquinolin-4-yl)-1,4,7-triazonan-1-yl]-5-oxopentanoic acid.
| Compound Name | 5-[4,7-bis(7-chloroquinolin-4-yl)-1,4,7-triazonan-1-yl]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 10816810 |
| Molecular Formula | C29H29Cl2N5O3 |
| Molecular Weight | 566.49 g/mol |
| Exact Mass | 565.16 |
| IUPAC Name | 5-[4,7-bis(7-chloroquinolin-4-yl)-1,4,7-triazonan-1-yl]-5-oxopentanoic acid |
| SMILES | O=C(O)CCCC(=O)N1CCN(c2ccnc3cc(Cl)ccc23)CCN(c2ccnc3cc(Cl)ccc23)CC1 |
| InChI | InChI=1S/C29H29Cl2N5O3/c30-20-4-6-22-24(18-20)32-10-8-26(22)34-12-13-35(27-9-11-33-25-19-21(31)5-7-23(25)27)15-17-36(16-14-34)28(37)2-1-3-29(38)39/h4-11,18-19H,1-3,12-17H2,(H,38,39) |
| InChIKey | XGGDQEWNTPWFSR-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.49 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |