C20H27ClN4O — CID 42704553
N-[2-[4-(7-chloroquinolin-4-yl)piperazin-1-yl]ethyl]pentanamide (PubChem CID 42704553) has the molecular formula C20H27ClN4O and a molecular weight of 374.92 g/mol. Its IUPAC name is N-[2-[4-(7-chloroquinolin-4-yl)piperazin-1-yl]ethyl]pentanamide.
| Compound Name | N-[2-[4-(7-chloroquinolin-4-yl)piperazin-1-yl]ethyl]pentanamide |
|---|---|
| PubChem CID | 42704553 |
| Molecular Formula | C20H27ClN4O |
| Molecular Weight | 374.92 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | N-[2-[4-(7-chloroquinolin-4-yl)piperazin-1-yl]ethyl]pentanamide |
| SMILES | CCCCC(=O)NCCN1CCN(c2ccnc3cc(Cl)ccc23)CC1 |
| InChI | InChI=1S/C20H27ClN4O/c1-2-3-4-20(26)23-9-10-24-11-13-25(14-12-24)19-7-8-22-18-15-16(21)5-6-17(18)19/h5-8,15H,2-4,9-14H2,1H3,(H,23,26) |
| InChIKey | KWPRGLHNDKXXLF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.92 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |