C20H28ClN5 — CID 125340732
7-chloro-4-[4-(3-piperazin-1-ylpropyl)piperazin-1-yl]quinoline (PubChem CID 125340732) has the molecular formula C20H28ClN5 and a molecular weight of 373.93 g/mol. Its IUPAC name is 7-chloro-4-[4-(3-piperazin-1-ylpropyl)piperazin-1-yl]quinoline.
| Compound Name | 7-chloro-4-[4-(3-piperazin-1-ylpropyl)piperazin-1-yl]quinoline |
|---|---|
| PubChem CID | 125340732 |
| Molecular Formula | C20H28ClN5 |
| Molecular Weight | 373.93 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 7-chloro-4-[4-(3-piperazin-1-ylpropyl)piperazin-1-yl]quinoline |
| SMILES | Clc1ccc2c(N3CCN(CCCN4CCNCC4)CC3)ccnc2c1 |
| InChI | InChI=1S/C20H28ClN5/c21-17-2-3-18-19(16-17)23-5-4-20(18)26-14-12-25(13-15-26)9-1-8-24-10-6-22-7-11-24/h2-5,16,22H,1,6-15H2 |
| InChIKey | WVLGMLBIFBVXLO-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 34.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.93 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |