C19H17ClN4O4 — CID 24830844
N-[1-(7-chloroquinolin-4-yl)piperidin-4-yl]-5-nitrofuran-2-carboxamide (PubChem CID 24830844) has the molecular formula C19H17ClN4O4 and a molecular weight of 400.82 g/mol. Its IUPAC name is N-[1-(7-chloroquinolin-4-yl)piperidin-4-yl]-5-nitrofuran-2-carboxamide.
| Compound Name | N-[1-(7-chloroquinolin-4-yl)piperidin-4-yl]-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 24830844 |
| Molecular Formula | C19H17ClN4O4 |
| Molecular Weight | 400.82 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | N-[1-(7-chloroquinolin-4-yl)piperidin-4-yl]-5-nitrofuran-2-carboxamide |
| SMILES | O=C(NC1CCN(c2ccnc3cc(Cl)ccc23)CC1)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C19H17ClN4O4/c20-12-1-2-14-15(11-12)21-8-5-16(14)23-9-6-13(7-10-23)22-19(25)17-3-4-18(28-17)24(26)27/h1-5,8,11,13H,6-7,9-10H2,(H,22,25) |
| InChIKey | KXZHELPAZWTQDK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 101.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.82 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|