C21H20BrClN4OS — CID 87695026
1-(3-bromophenyl)-3-[1-(7-chloroquinolin-4-yl)piperidin-4-yl]-1-sulfanylurea (PubChem CID 87695026) has the molecular formula C21H20BrClN4OS and a molecular weight of 491.84 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3-[1-(7-chloroquinolin-4-yl)piperidin-4-yl]-1-sulfanylurea.
| Compound Name | 1-(3-bromophenyl)-3-[1-(7-chloroquinolin-4-yl)piperidin-4-yl]-1-sulfanylurea |
|---|---|
| PubChem CID | 87695026 |
| Molecular Formula | C21H20BrClN4OS |
| Molecular Weight | 491.84 g/mol |
| Exact Mass | 490.02 |
| IUPAC Name | 1-(3-bromophenyl)-3-[1-(7-chloroquinolin-4-yl)piperidin-4-yl]-1-sulfanylurea |
| SMILES | O=C(NC1CCN(c2ccnc3cc(Cl)ccc23)CC1)N(S)c1cccc(Br)c1 |
| InChI | InChI=1S/C21H20BrClN4OS/c22-14-2-1-3-17(12-14)27(29)21(28)25-16-7-10-26(11-8-16)20-6-9-24-19-13-15(23)4-5-18(19)20/h1-6,9,12-13,16,29H,7-8,10-11H2,(H,25,28) |
| InChIKey | FFINVMAJNIBQOI-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.84 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|