C21H18ClF2N3O — CID 68881320
N-[1-(6-chloroisoquinolin-1-yl)piperidin-4-yl]-2,4-difluorobenzamide (PubChem CID 68881320) has the molecular formula C21H18ClF2N3O and a molecular weight of 401.84 g/mol. Its IUPAC name is N-[1-(6-chloroisoquinolin-1-yl)piperidin-4-yl]-2,4-difluorobenzamide.
| Compound Name | N-[1-(6-chloroisoquinolin-1-yl)piperidin-4-yl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 68881320 |
| Molecular Formula | C21H18ClF2N3O |
| Molecular Weight | 401.84 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | N-[1-(6-chloroisoquinolin-1-yl)piperidin-4-yl]-2,4-difluorobenzamide |
| SMILES | O=C(NC1CCN(c2nccc3cc(Cl)ccc23)CC1)c1ccc(F)cc1F |
| InChI | InChI=1S/C21H18ClF2N3O/c22-14-1-3-17-13(11-14)5-8-25-20(17)27-9-6-16(7-10-27)26-21(28)18-4-2-15(23)12-19(18)24/h1-5,8,11-12,16H,6-7,9-10H2,(H,26,28) |
| InChIKey | CGBQMLFINPUHDN-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.84 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |