C19H19ClF3N3O3S — CID 55794396
1-[(2-chloro-3-pyridinyl)sulfonyl]-N-(2,2,2-trifluoro-1-phenylethyl)piperidine-4-carboxamide (PubChem CID 55794396) has the molecular formula C19H19ClF3N3O3S and a molecular weight of 461.89 g/mol. Its IUPAC name is 1-[(2-chloro-3-pyridinyl)sulfonyl]-N-(2,2,2-trifluoro-1-phenylethyl)piperidine-4-carboxamide.
| Compound Name | 1-[(2-chloro-3-pyridinyl)sulfonyl]-N-(2,2,2-trifluoro-1-phenylethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55794396 |
| Molecular Formula | C19H19ClF3N3O3S |
| Molecular Weight | 461.89 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | 1-[(2-chloro-3-pyridinyl)sulfonyl]-N-(2,2,2-trifluoro-1-phenylethyl)piperidine-4-carboxamide |
| SMILES | O=C(NC(c1ccccc1)C(F)(F)F)C1CCN(S(=O)(=O)c2cccnc2Cl)CC1 |
| InChI | InChI=1S/C19H19ClF3N3O3S/c20-17-15(7-4-10-24-17)30(28,29)26-11-8-14(9-12-26)18(27)25-16(19(21,22)23)13-5-2-1-3-6-13/h1-7,10,14,16H,8-9,11-12H2,(H,25,27) |
| InChIKey | ZPHFNKNGRKVVTI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.89 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|