C20H21ClF2N4O4S — CID 55509813
1-[(2-chloro-3-pyridinyl)sulfonyl]-N-[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]piperidine-4-carboxamide (PubChem CID 55509813) has the molecular formula C20H21ClF2N4O4S and a molecular weight of 486.93 g/mol. Its IUPAC name is 1-[(2-chloro-3-pyridinyl)sulfonyl]-N-[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]piperidine-4-carboxamide.
| Compound Name | 1-[(2-chloro-3-pyridinyl)sulfonyl]-N-[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55509813 |
| Molecular Formula | C20H21ClF2N4O4S |
| Molecular Weight | 486.93 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | 1-[(2-chloro-3-pyridinyl)sulfonyl]-N-[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]piperidine-4-carboxamide |
| SMILES | CNC(=O)C(NC(=O)C1CCN(S(=O)(=O)c2cccnc2Cl)CC1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H21ClF2N4O4S/c1-24-20(29)17(13-4-5-14(22)15(23)11-13)26-19(28)12-6-9-27(10-7-12)32(30,31)16-3-2-8-25-18(16)21/h2-5,8,11-12,17H,6-7,9-10H2,1H3,(H,24,29)(H,26,28) |
| InChIKey | XNOGXPVBXPWWIC-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.93 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|