C15H14ClN3O3S — CID 24650969
N-[4-[(2-chloro-3-pyridinyl)sulfonylamino]phenyl]cyclopropanecarboxamide (PubChem CID 24650969) has the molecular formula C15H14ClN3O3S and a molecular weight of 351.82 g/mol. Its IUPAC name is N-[4-[(2-chloro-3-pyridinyl)sulfonylamino]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[(2-chloro-3-pyridinyl)sulfonylamino]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 24650969 |
| Molecular Formula | C15H14ClN3O3S |
| Molecular Weight | 351.82 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | N-[4-[(2-chloro-3-pyridinyl)sulfonylamino]phenyl]cyclopropanecarboxamide |
| SMILES | O=C(Nc1ccc(NS(=O)(=O)c2cccnc2Cl)cc1)C1CC1 |
| InChI | InChI=1S/C15H14ClN3O3S/c16-14-13(2-1-9-17-14)23(21,22)19-12-7-5-11(6-8-12)18-15(20)10-3-4-10/h1-2,5-10,19H,3-4H2,(H,18,20) |
| InChIKey | TXCMETBBZKJVEC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.82 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|