C14H14ClN3O3S — CID 24650939
4-[(2-chloro-3-pyridinyl)sulfonylamino]-N,N-dimethylbenzamide (PubChem CID 24650939) has the molecular formula C14H14ClN3O3S and a molecular weight of 339.80 g/mol. Its IUPAC name is 4-[(2-chloro-3-pyridinyl)sulfonylamino]-N,N-dimethylbenzamide.
| Compound Name | 4-[(2-chloro-3-pyridinyl)sulfonylamino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 24650939 |
| Molecular Formula | C14H14ClN3O3S |
| Molecular Weight | 339.80 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | 4-[(2-chloro-3-pyridinyl)sulfonylamino]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(NS(=O)(=O)c2cccnc2Cl)cc1 |
| InChI | InChI=1S/C14H14ClN3O3S/c1-18(2)14(19)10-5-7-11(8-6-10)17-22(20,21)12-4-3-9-16-13(12)15/h3-9,17H,1-2H3 |
| InChIKey | VOXFRPDZWXIFRE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.80 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|