C16H18ClN3O3S — CID 24621380
4-[(2-chloro-3-pyridinyl)sulfonylamino]-N,N-diethylbenzamide (PubChem CID 24621380) has the molecular formula C16H18ClN3O3S and a molecular weight of 367.86 g/mol. Its IUPAC name is 4-[(2-chloro-3-pyridinyl)sulfonylamino]-N,N-diethylbenzamide.
| Compound Name | 4-[(2-chloro-3-pyridinyl)sulfonylamino]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 24621380 |
| Molecular Formula | C16H18ClN3O3S |
| Molecular Weight | 367.86 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 4-[(2-chloro-3-pyridinyl)sulfonylamino]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(NS(=O)(=O)c2cccnc2Cl)cc1 |
| InChI | InChI=1S/C16H18ClN3O3S/c1-3-20(4-2)16(21)12-7-9-13(10-8-12)19-24(22,23)14-6-5-11-18-15(14)17/h5-11,19H,3-4H2,1-2H3 |
| InChIKey | OGPVWWLRKOTLIO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.86 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|