About 4-[(2-chloro-3-pyridinyl)sulfonylamino]-N,N-diethylbenzamide
4-[(2-chloro-3-pyridinyl)sulfonylamino]-N,N-diethylbenzamide (PubChem CID 24621380) has the molecular formula C16H18ClN3O3S
and a molecular weight of 367.86 g/mol. Its IUPAC name is 4-[(2-chloro-3-pyridinyl)sulfonylamino]-N,N-diethylbenzamide.
Molecular Properties
| Compound Name | 4-[(2-chloro-3-pyridinyl)sulfonylamino]-N,N-diethylbenzamide |
| PubChem CID | 24621380 |
| Molecular Formula | C16H18ClN3O3S |
| Molecular Weight | 367.86 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 4-[(2-chloro-3-pyridinyl)sulfonylamino]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(NS(=O)(=O)c2cccnc2Cl)cc1 |
| InChI | InChI=1S/C16H18ClN3O3S/c1-3-20(4-2)16(21)12-7-9-13(10-8-12)19-24(22,23)14-6-5-11-18-15(14)17/h5-11,19H,3-4H2,1-2H3 |
| InChIKey | OGPVWWLRKOTLIO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.86 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2-chloro-3-pyridinyl)sulfonylamino]-N,N-diethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-chloro-3-pyridinyl)sulfonylamino]-N,N-diethylbenzamide?
The IUPAC name of 4-[(2-chloro-3-pyridinyl)sulfonylamino]-N,N-diethylbenzamide (CID 24621380) is 4-[(2-chloro-3-pyridinyl)sulfonylamino]-N,N-diethylbenzamide.
What is the SMILES notation for 4-[(2-chloro-3-pyridinyl)sulfonylamino]-N,N-diethylbenzamide?
The canonical SMILES for 4-[(2-chloro-3-pyridinyl)sulfonylamino]-N,N-diethylbenzamide is CCN(CC)C(=O)c1ccc(NS(=O)(=O)c2cccnc2Cl)cc1.
What is the InChIKey of 4-[(2-chloro-3-pyridinyl)sulfonylamino]-N,N-diethylbenzamide?
The InChIKey is OGPVWWLRKOTLIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18ClN3O3S/c1-3-20(4-2)16(21)12-7-9-13(10-8-12)19-24(22,23)14-6-5-11-18-15(14)17/h5-11,19H,3-4H2,1-2H3.
What are the key properties of 4-[(2-chloro-3-pyridinyl)sulfonylamino]-N,N-diethylbenzamide?
4-[(2-chloro-3-pyridinyl)sulfonylamino]-N,N-diethylbenzamide has a molecular weight of 367.86 g/mol, XLogP of 3.02, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-chloro-3-pyridinyl)sulfonylamino]-N,N-diethylbenzamide is sourced from PubChem (CID 24621380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).